EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H32O9 |
| Net Charge | 0 |
| Average Mass | 560.599 |
| Monoisotopic Mass | 560.20463 |
| SMILES | [H][C@@]12Cc3c(OC)c(C)c(O)c(C(=O)C(C)CC)c3OC1(c1ccc3c(c1)OCO3)O[C@H](c1ccc3c(c1)OCO3)C2 |
| InChI | InChI=1S/C32H32O9/c1-5-16(2)28(33)27-29(34)17(3)30(35-4)21-11-20-13-24(18-6-8-22-25(10-18)38-14-36-22)40-32(20,41-31(21)27)19-7-9-23-26(12-19)39-15-37-23/h6-10,12,16,20,24,34H,5,11,13-15H2,1-4H3/t16?,20-,24-,32?/m0/s1 |
| InChIKey | QQKWQUVKXGHNEF-PJSQIOKLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum chinense (IPNI:433315-1) | leaf (BTO:0000713) | PubMed (21043475) | 95% EtOH extract of dried, chopped leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyperaspidinol B (CHEBI:70397) has role metabolite (CHEBI:25212) |
| hyperaspidinol B (CHEBI:70397) is a ether (CHEBI:25698) |
| Citations |
|---|