EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H32O9 |
| Net Charge | 0 |
| Average Mass | 560.599 |
| Monoisotopic Mass | 560.20463 |
| SMILES | [H][C@@]12Cc3c(OC)c(C)c(O)c(C(=O)CC(C)C)c3OC1(c1ccc3c(c1)OCO3)O[C@H](c1ccc3c(c1)OCO3)C2 |
| InChI | InChI=1S/C32H32O9/c1-16(2)9-22(33)28-29(34)17(3)30(35-4)21-11-20-13-25(18-5-7-23-26(10-18)38-14-36-23)40-32(20,41-31(21)28)19-6-8-24-27(12-19)39-15-37-24/h5-8,10,12,16,20,25,34H,9,11,13-15H2,1-4H3/t20-,25-,32?/m0/s1 |
| InChIKey | YDLZATQDFWVOBH-XCOQECSBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum chinense (IPNI:433315-1) | leaf (BTO:0000713) | PubMed (21043475) | 95% EtOH extract of dried, chopped leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyperaspidinol A (CHEBI:70396) has role plant metabolite (CHEBI:76924) |
| hyperaspidinol A (CHEBI:70396) is a aromatic ketone (CHEBI:76224) |
| hyperaspidinol A (CHEBI:70396) is a benzodioxoles (CHEBI:38298) |
| hyperaspidinol A (CHEBI:70396) is a monomethoxybenzene (CHEBI:25235) |
| hyperaspidinol A (CHEBI:70396) is a organic heterotricyclic compound (CHEBI:26979) |
| hyperaspidinol A (CHEBI:70396) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 1-[(2S,3aS)-2,9a-bis(2H-1,3-benzodioxol-5-yl)-7-hydroxy-5-methoxy-6-methyl-2,3,3a,9a-tetrahydro-4H-furo[2,3-b][1]benzopyran-8-yl]-3-methylbutan-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21068378 | Reaxys |
| Citations |
|---|