EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O4 |
| Net Charge | 0 |
| Average Mass | 238.283 |
| Monoisotopic Mass | 238.12051 |
| SMILES | CCC(C)C(=O)c1c(O)cc(OC)c(C)c1O |
| InChI | InChI=1S/C13H18O4/c1-5-7(2)12(15)11-9(14)6-10(17-4)8(3)13(11)16/h6-7,14,16H,5H2,1-4H3 |
| InChIKey | HDRPUFIQLCTRLW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eucalyptus pulverulenta (ncbitaxon:881203) | - | PubMed (21043475) | |
| Hypericum chinense (IPNI:433315-1) | leaf (BTO:0000713) | PubMed (21043475) | 95% EtOH extract of dried, chopped leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspidinol D (CHEBI:70395) has functional parent phloroglucinol (CHEBI:16204) |
| Aspidinol D (CHEBI:70395) has role metabolite (CHEBI:25212) |
| Aspidinol D (CHEBI:70395) is a carboxylic ester (CHEBI:33308) |
| Synonym | Source |
|---|---|
| 1-(2,6-dihydroxy-4-methoxy-3-methylphenyl)-2-methylbutan-1-one | ChEBI |
| Citations |
|---|