EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O6 |
| Net Charge | 0 |
| Average Mass | 340.331 |
| Monoisotopic Mass | 340.09469 |
| SMILES | O=C(c1ccc2c(c1)OCO2)[C@H]1CO[C@@H](c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C19H16O6/c20-19(12-2-4-15-18(6-12)25-10-23-15)13-7-16(21-8-13)11-1-3-14-17(5-11)24-9-22-14/h1-6,13,16H,7-10H2/t13-,16-/m1/s1 |
| InChIKey | USTIGIXBHGGRBQ-CZUORRHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum chinense (IPNI:433315-1) | leaf (BTO:0000713) | PubMed (21043475) | 95% EtOH extract of dried, chopped leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyperione A, (rel)- (CHEBI:70392) has role metabolite (CHEBI:25212) |
| hyperione A, (rel)- (CHEBI:70392) is a benzodioxoles (CHEBI:38298) |
| Synonym | Source |
|---|---|
| rel-1,3-Benzodioxol-5-yl[(3R,5R)-5-(1,3-benzodioxol-5-yl)tetrahydro-3-furanyl]methanone | ChEBI |
| Citations |
|---|