EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O5 |
| Net Charge | 0 |
| Average Mass | 362.466 |
| Monoisotopic Mass | 362.20932 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@](C1)(C(=O)OC[C@]31CCC[C@@]3(C)CO[C@H](OC)[C@]31[H])C(=O)[C@@H]2C |
| InChI | InChI=1S/C21H30O5/c1-12-13-5-6-14-20(11-26-18(23)21(14,9-13)16(12)22)8-4-7-19(2)10-25-17(24-3)15(19)20/h12-15,17H,4-11H2,1-3H3/t12-,13-,14+,15-,17+,19+,20-,21+/m1/s1 |
| InChIKey | YPVJSAYFTDREBJ-CQVBDWECSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ludongnin I (CHEBI:70388) has role metabolite (CHEBI:25212) |
| Ludongnin I (CHEBI:70388) is a δ-lactone (CHEBI:18946) |
| Synonym | Source |
|---|---|
| (1'S,3S,3aR,4R,6'S,7aR,9'R,10'R)-3-Methoxy-7a,10'-dimethylhexahydro-1H,11'H-spiro[2-benzofuran-4,5'-[3]oxatricyclo[7.2.1.0(1,6)]dodecane]-2',11'-dione | ChEBI |
| Citations |
|---|