EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O9 |
| Net Charge | 0 |
| Average Mass | 462.495 |
| Monoisotopic Mass | 462.18898 |
| SMILES | [H][C@@]12C[C@@H](O)[C@]3([H])[C@](C1)(C(=O)OC[C@]31CC[C@H](OC(C)=O)[C@@](C)(COC(C)=O)[C@H]1C=O)C(=O)C2=C |
| InChI | InChI=1S/C24H30O9/c1-12-15-7-16(28)19-23(11-32-21(30)24(19,8-15)20(12)29)6-5-18(33-14(3)27)22(4,17(23)9-25)10-31-13(2)26/h9,15-19,28H,1,5-8,10-11H2,2-4H3/t15-,16-,17-,18+,19+,22+,23+,24+/m1/s1 |
| InChIKey | BAQMGVVHZMKNPB-AULQEXAJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coetsin B (CHEBI:70383) has role metabolite (CHEBI:25212) |
| coetsin B (CHEBI:70383) is a δ-lactone (CHEBI:18946) |
| Citations |
|---|