EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O2 |
| Net Charge | 0 |
| Average Mass | 306.490 |
| Monoisotopic Mass | 306.25588 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@@]1(CC[C@]1([H])C(C)(C)[C@@H](O)CC[C@@]21C)C[C@@]3(C)O |
| InChI | InChI=1S/C20H34O2/c1-17(2)14-7-10-20-11-13(19(4,22)12-20)5-6-15(20)18(14,3)9-8-16(17)21/h13-16,21-22H,5-12H2,1-4H3/t13?,14-,15+,16+,18-,19-,20+/m1/s1 |
| InChIKey | VUJZEWLGPXJQEB-KTZJQMJJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| entkaurane-3beta,16beta-diol (CHEBI:70381) has role metabolite (CHEBI:25212) |
| entkaurane-3beta,16beta-diol (CHEBI:70381) is a kaurane diterpenoid (CHEBI:53666) |
| Citations |
|---|