EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:70378 - Enmein
| Formula | C20H26O6 |
| Net Charge | 0 |
| Average Mass | 362.422 |
| Monoisotopic Mass | 362.17294 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@@]1(C(=O)O[C@@]1([H])C[C@H](O)C(C)(C)[C@@]4([H])[C@H](O)OC[C@@]214)C(=O)C3=C |
| InChI | InChI=1S/C20H26O6/c1-9-10-4-5-11-19(7-10,15(9)22)17(24)26-13-6-12(21)18(2,3)14-16(23)25-8-20(11,13)14/h10-14,16,21,23H,1,4-8H2,2-3H3/t10-,11-,12+,13+,14-,16-,19+,20-/m1/s1 |
| InChIKey | MQOJPNKACWKUGI-CDKPERABSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Enmein (CHEBI:70378) has role metabolite (CHEBI:25212) |
| Enmein (CHEBI:70378) is a δ-lactone (CHEBI:18946) |
| Synonyms | Source |
|---|---|
| Enmein | KEGG COMPOUND |
| 5H-5a,8-Methano-11H-cyclohepta(c)furo(3,4-e)(1)benzopyran-5,6(7H)-dione, decahydro-2,13-dihydroxy-1,1-dimethyl-7-methylene-, (2S,3as,5as,7R,8R,10aS,10bS,13R,13aR)- | ChEBI |
| Isodonine | ChEBI |
| Sculponeatin D | ChEBI |
| Citations |
|---|