EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O5 |
| Net Charge | 0 |
| Average Mass | 362.466 |
| Monoisotopic Mass | 362.20932 |
| SMILES | [H][C@@]12CC[C@]3([H])C(=C)C(=O)[C@]1([C@H]1C[C@]4([H])C(C)(C)CC[C@H](O)[C@@]24[C@@H](OC)O1)[C@@H]3O |
| InChI | InChI=1S/C21H30O5/c1-10-11-5-6-12-20-13(19(2,3)8-7-14(20)22)9-15(26-18(20)25-4)21(12,16(10)23)17(11)24/h11-15,17-18,22,24H,1,5-9H2,2-4H3/t11-,12+,13-,14+,15-,17-,18+,20-,21+/m1/s1 |
| InChIKey | HZXIWBLGRBHNQF-ZVXCJKLWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kamebacetal A (CHEBI:70375) has role metabolite (CHEBI:25212) |
| kamebacetal A (CHEBI:70375) is a kaurane diterpenoid (CHEBI:53666) |
| Citations |
|---|