EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O6 |
| Net Charge | 0 |
| Average Mass | 390.476 |
| Monoisotopic Mass | 390.20424 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(C(=O)C3=C)[C@@]1(O)OC[C@]23CCC[C@@](C)(COC(C)=O)[C@@]3([H])[C@@H]1O |
| InChI | InChI=1S/C22H30O6/c1-12-14-5-6-15-20-8-4-7-19(3,10-27-13(2)23)16(20)18(25)22(26,28-11-20)21(15,9-14)17(12)24/h14-16,18,25-26H,1,4-11H2,2-3H3/t14?,15-,16+,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | HSMCZGYOVWATPU-FSKRNUERSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| longikaurin C (CHEBI:70372) has role metabolite (CHEBI:25212) |
| longikaurin C (CHEBI:70372) is a kaurane diterpenoid (CHEBI:53666) |
| Citations |
|---|