EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | [H][C@@]12CC[C@@H](C(=C)C=O)C[C@@]1([H])C(=O)[C@@H](O)[C@]1([H])C(C)(C)[C@H](O)CC[C@@]21C |
| InChI | InChI=1S/C20H30O4/c1-11(10-21)12-5-6-14-13(9-12)16(23)17(24)18-19(2,3)15(22)7-8-20(14,18)4/h10,12-15,17-18,22,24H,1,5-9H2,2-4H3/t12-,13-,14-,15-,17-,18-,20+/m1/s1 |
| InChIKey | PYTXCJKULGAJQT-WEMZJFJNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3alpha,6beta-dihydroxy-7,17-dioxo-ent-abieta-15(16)-ene (CHEBI:70368) has role metabolite (CHEBI:25212) |
| 3alpha,6beta-dihydroxy-7,17-dioxo-ent-abieta-15(16)-ene (CHEBI:70368) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|