EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O7 |
| Net Charge | 0 |
| Average Mass | 434.529 |
| Monoisotopic Mass | 434.23045 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@]4(C)[C@@H](O)CC[C@@](C)(COC(C)=O)[C@@]4([H])[C@H](OC(C)=O)C(=O)[C@]3(C1)[C@H](O)C2=C |
| InChI | InChI=1S/C24H34O7/c1-12-15-6-7-16-23(5)17(27)8-9-22(4,11-30-13(2)25)19(23)18(31-14(3)26)21(29)24(16,10-15)20(12)28/h15-20,27-28H,1,6-11H2,2-5H3/t15-,16+,17+,18+,19-,20-,22+,23-,24+/m1/s1 |
| InChIKey | YLAQTEHVFWEICH-MQAPUGLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maoesin E, (rel)- (CHEBI:70367) has role metabolite (CHEBI:25212) |
| Maoesin E, (rel)- (CHEBI:70367) is a kaurane diterpenoid (CHEBI:53666) |
| Synonym | Source |
|---|---|
| rel-6beta,19-diacetoxy-1alpha,15beta-dihydroxy-ent-kaur-16-en-7-one | ChEBI |
| Citations |
|---|