EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O8 |
| Net Charge | 0 |
| Average Mass | 446.496 |
| Monoisotopic Mass | 446.19407 |
| SMILES | [H][C@@]12C=C[C@]3([H])C[C@]1(C(=O)C3=C)[C@@]1(O)OC[C@]23CC[C@H](OC(C)=O)[C@@](C)(COC(C)=O)[C@@]3([H])[C@@H]1O |
| InChI | InChI=1S/C24H30O8/c1-12-15-5-6-16-22-8-7-17(32-14(3)26)21(4,10-30-13(2)25)18(22)20(28)24(29,31-11-22)23(16,9-15)19(12)27/h5-6,15-18,20,28-29H,1,7-11H2,2-4H3/t15-,16+,17+,18-,20+,21-,22-,23+,24+/m1/s1 |
| InChIKey | FUWZKRPAEKGTSW-MIWKWXCYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maoesin D (CHEBI:70366) has role metabolite (CHEBI:25212) |
| Maoesin D (CHEBI:70366) is a kaurane diterpenoid (CHEBI:53666) |
| Synonym | Source |
|---|---|
| 3beta,19-diacetoxy-6beta,7beta,11alpha-trihydroxy-7alpha,20-epoxy-ent-kaur-11,16-dien-15-one | ChEBI |
| Citations |
|---|