EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O8 |
| Net Charge | 0 |
| Average Mass | 420.458 |
| Monoisotopic Mass | 420.17842 |
| SMILES | [H][C@]12C[C@H]3O[C@H](O)[C@]4([H])[C@](C)(COC(C)=O)CC[C@@]5([H])OC(=O)[C@](C1)(C(=O)C2=C)[C@]3([H])[C@@]45CO |
| InChI | InChI=1S/C22H28O8/c1-10-12-6-13-15-21(7-12,17(10)25)19(27)30-14-4-5-20(3,9-28-11(2)24)16(18(26)29-13)22(14,15)8-23/h12-16,18,23,26H,1,4-9H2,2-3H3/t12-,13+,14+,15+,16+,18-,20-,21-,22-/m0/s1 |
| InChIKey | DESAYGPOWNGKKW-WJUAMAEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maoesin A, (rel)- (CHEBI:70362) has role metabolite (CHEBI:25212) |
| Maoesin A, (rel)- (CHEBI:70362) is a δ-lactone (CHEBI:18946) |
| Synonym | Source |
|---|---|
| rel-19-acetoxy-6alpha,20-dihydroxy-6,11beta-epoxy-15-oxo-6,7-seco-ent-kaur-16-en-1beta,7-olide | ChEBI |
| Citations |
|---|