EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O5 |
| Net Charge | 0 |
| Average Mass | 378.509 |
| Monoisotopic Mass | 378.24062 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)C[C@@H](C(=C)CO)C[C@@]1([H])C(=O)[C@@H](O)[C@]1([H])C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C22H34O5/c1-12(11-23)14-9-15-17(16(10-14)27-13(2)24)22(5)8-6-7-21(3,4)20(22)19(26)18(15)25/h14-17,19-20,23,26H,1,6-11H2,2-5H3/t14-,15+,16+,17-,19+,20+,22-/m0/s1 |
| InChIKey | LSHXXXQWPVHVRD-XONTYPPSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eriocasin E (CHEBI:70361) has role metabolite (CHEBI:25212) |
| Eriocasin E (CHEBI:70361) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| 11alpha-acetoxy-6beta,16-dihydroxy-7-oxo-ent-abieta-15(17)-ene | ChEBI |
| Citations |
|---|