EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O7 |
| Net Charge | 0 |
| Average Mass | 434.529 |
| Monoisotopic Mass | 434.23045 |
| SMILES | [H][C@@]12CC[C@@H](C(=C)C=O)C[C@@]1([H])C(=O)[C@@H](O)[C@@]1([H])[C@@]2(C)CC[C@H](OC(C)=O)[C@@]1(C)COC(C)=O |
| InChI | InChI=1S/C24H34O7/c1-13(11-25)16-6-7-18-17(10-16)20(28)21(29)22-23(18,4)9-8-19(31-15(3)27)24(22,5)12-30-14(2)26/h11,16-19,21-22,29H,1,6-10,12H2,2-5H3/t16-,17-,18-,19+,21-,22+,23+,24-/m1/s1 |
| InChIKey | LKBMNVLYWWORRA-QLKQUVKYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-acetyleriocasin C, (rel)- (CHEBI:70359) has role metabolite (CHEBI:25212) |
| 3-acetyleriocasin C, (rel)- (CHEBI:70359) is a 7α-hydroxy steroid (CHEBI:36843) |
| Synonym | Source |
|---|---|
| rel-6beta,19-diacetoxy-6beta-hydroxy-7,16-dioxo-ent-abieta-15(17)-ene | ChEBI |
| Citations |
|---|