EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O6 |
| Net Charge | 0 |
| Average Mass | 392.492 |
| Monoisotopic Mass | 392.21989 |
| SMILES | [H][C@@]12CC[C@@H](C(=C)C=O)C[C@@]1([H])C(=O)[C@@H](O)[C@@]1([H])[C@@]2(C)CC[C@H](O)[C@@]1(C)COC(C)=O |
| InChI | InChI=1S/C22H32O6/c1-12(10-23)14-5-6-16-15(9-14)18(26)19(27)20-21(16,3)8-7-17(25)22(20,4)11-28-13(2)24/h10,14-17,19-20,25,27H,1,5-9,11H2,2-4H3/t14-,15-,16-,17+,19-,20+,21+,22-/m1/s1 |
| InChIKey | JZFWRUQOQHVXDM-UDTDVKRRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | aerial part (BTO:0001658) | PubMed (20949916) | 70% aqueous Me2CO extract of air-dried and powdered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eriocasin C (CHEBI:70357) has role metabolite (CHEBI:25212) |
| Eriocasin C (CHEBI:70357) is a 7α-hydroxy steroid (CHEBI:36843) |
| Synonym | Source |
|---|---|
| 19-acetoxy-3beta,6beta-dihydroxy-7,16-dioxo-ent-abieta-15(17)-ene | ChEBI |
| Citations |
|---|