EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O4 |
| Net Charge | 0 |
| Average Mass | 238.283 |
| Monoisotopic Mass | 238.12051 |
| SMILES | C=CCc1cc(OC)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C13H18O4/c1-6-7-9-8-10(14-2)12(16-4)13(17-5)11(9)15-3/h6,8H,1,7H2,2-5H3 |
| InChIKey | HRAXJWRHSUTMCS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petroselinum crispum (ncbitaxon:4043) | seed (BTO:0001226) | PubMed (21049975) | Essential oil of seeds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allyltetramethoxybenzene (CHEBI:70354) has role metabolite (CHEBI:25212) |
| allyltetramethoxybenzene (CHEBI:70354) is a benzenetriol (CHEBI:22707) |
| Synonym | Source |
|---|---|
| 1,2,3,4-tetramethoxy-5-prop-2-enylbenzene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034046 | HMDB |
| Citations |
|---|