EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O4 |
| Net Charge | 0 |
| Average Mass | 222.240 |
| Monoisotopic Mass | 222.08921 |
| SMILES | C=CCc1cc(OC)c2c(c1OC)OCO2 |
| InChI | InChI=1S/C12H14O4/c1-4-5-8-6-9(13-2)11-12(10(8)14-3)16-7-15-11/h4,6H,1,5,7H2,2-3H3 |
| InChIKey | QQRSPHJOOXUALR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petroselinum crispum (ncbitaxon:4043) | seed (BTO:0001226) | PubMed (21049975) | Essential oil of seeds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apiole (CHEBI:70353) has role metabolite (CHEBI:25212) |
| Apiole (CHEBI:70353) is a benzodioxoles (CHEBI:38298) |
| Synonyms | Source |
|---|---|
| 1,3-Benzodioxole, 4,7-dimethoxy-5-(2-propen-1-yl)- | ChEBI |
| 5-Allyl-4,7-dimethoxy-1,3-benzodioxole | ChEBI |
| Apiole | KEGG COMPOUND |
| Benzene, 1-allyl-2,5-dimethoxy-3,4-(methylenedioxy)- | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 83382-66-5 | ChemIDplus |
| C00002714 | KNApSAcK |
| C10429 | KEGG COMPOUND |
| HMDB0033776 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:523-80-8 | KEGG COMPOUND |
| Citations |
|---|