EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O6 |
| Net Charge | 0 |
| Average Mass | 348.395 |
| Monoisotopic Mass | 348.15729 |
| SMILES | COc1cc(OC)c(OC)cc1CCCc1ccc(OC)c(O)c1O |
| InChI | InChI=1S/C19H24O6/c1-22-14-9-8-12(18(20)19(14)21)6-5-7-13-10-16(24-3)17(25-4)11-15(13)23-2/h8-11,20-21H,5-7H2,1-4H3 |
| InChIKey | JUBOCNOOUXAKKN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bussea sakalava (ncbitaxon:321565) | root (BTO:0001188) | PubMed (20942441) | Dried, ground roots were extracted with ethanol by percolation |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bussealin D (CHEBI:70351) has role metabolite (CHEBI:25212) |
| Bussealin D (CHEBI:70351) is a catechols (CHEBI:33566) |
| Bussealin D (CHEBI:70351) is a methoxybenzenes (CHEBI:51683) |
| Synonym | Source |
|---|---|
| 3-methoxy-6-(3-(2,4,5-trimethoxyphenyl)propyl)benzene-1,2-diol | ChEBI |
| Citations |
|---|