EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O5 |
| Net Charge | 0 |
| Average Mass | 304.342 |
| Monoisotopic Mass | 304.13107 |
| SMILES | COc1ccc(CCCc2ccc(OC)c(O)c2O)cc1O |
| InChI | InChI=1S/C17H20O5/c1-21-14-8-6-11(10-13(14)18)4-3-5-12-7-9-15(22-2)17(20)16(12)19/h6-10,18-20H,3-5H2,1-2H3 |
| InChIKey | XEIIFLOQVMORAW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bussea sakalava (ncbitaxon:321565) | root (BTO:0001188) | PubMed (20942441) | Dried, ground roots were extracted with ethanol by percolation |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bussealin C (CHEBI:70350) has role metabolite (CHEBI:25212) |
| Bussealin C (CHEBI:70350) is a phenols (CHEBI:33853) |
| Synonym | Source |
|---|---|
| 3',2'',3''-Trihydroxy-4',4''-dimethoxy-1,3-diphenylpropane | ChEBI |
| Citations |
|---|