EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N2O2 |
| Net Charge | 0 |
| Average Mass | 114.104 |
| Monoisotopic Mass | 114.04293 |
| SMILES | NCc1cc(=O)no1 |
| InChI | InChI=1S/C4H6N2O2/c5-2-3-1-4(7)6-8-3/h1H,2,5H2,(H,6,7) |
| InChIKey | ZJQHPWUVQPJPQT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. oneirogen Any substance that produces or enhances dream-like states of consciousness. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| muscimol (CHEBI:7035) has role fungal metabolite (CHEBI:76946) |
| muscimol (CHEBI:7035) has role GABA agonist (CHEBI:51373) |
| muscimol (CHEBI:7035) has role oneirogen (CHEBI:146270) |
| muscimol (CHEBI:7035) has role psychotropic drug (CHEBI:35471) |
| muscimol (CHEBI:7035) is a alkaloid (CHEBI:22315) |
| muscimol (CHEBI:7035) is a isoxazoles (CHEBI:55373) |
| muscimol (CHEBI:7035) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 5-(aminomethyl)-1,2-oxazol-3(2H)-one |
| Synonyms | Source |
|---|---|
| 5-(aminomethyl)-3(2H)-isoxazolone | ChemIDplus |
| Muscimol | KEGG COMPOUND |
| Citations |
|---|