EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N2O2 |
| Net Charge | 0 |
| Average Mass | 114.104 |
| Monoisotopic Mass | 114.04293 |
| SMILES | NCc1cc(=O)no1 |
| InChI | InChI=1S/C4H6N2O2/c5-2-3-1-4(7)6-8-3/h1H,2,5H2,(H,6,7) |
| InChIKey | ZJQHPWUVQPJPQT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | GABA agonist A drug that binds to and activates γ-aminobutyric acid receptors. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. oneirogen Any substance that produces or enhances dream-like states of consciousness. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| muscimol (CHEBI:7035) has role fungal metabolite (CHEBI:76946) |
| muscimol (CHEBI:7035) has role GABA agonist (CHEBI:51373) |
| muscimol (CHEBI:7035) has role oneirogen (CHEBI:146270) |
| muscimol (CHEBI:7035) has role psychotropic drug (CHEBI:35471) |
| muscimol (CHEBI:7035) is a alkaloid (CHEBI:22315) |
| muscimol (CHEBI:7035) is a isoxazoles (CHEBI:55373) |
| muscimol (CHEBI:7035) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 5-(aminomethyl)-1,2-oxazol-3(2H)-one |
| Synonyms | Source |
|---|---|
| 5-(aminomethyl)-3(2H)-isoxazolone | ChemIDplus |
| Muscimol | KEGG COMPOUND |
| Citations |
|---|