EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O3 |
| Net Charge | 0 |
| Average Mass | 428.657 |
| Monoisotopic Mass | 428.32905 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CCC1=C2[C@H](O)[C@]2([H])O[C@@]23C[C@@H](O)CC[C@]13C |
| InChI | InChI=1S/C28H44O3/c1-16(2)17(3)7-8-18(4)20-9-10-21-23-22(12-13-26(20,21)5)27(6)14-11-19(29)15-28(27)25(31-28)24(23)30/h7-8,16-21,24-25,29-30H,9-15H2,1-6H3/b8-7+/t17-,18+,19-,20+,21-,24-,25-,26+,27+,28-/m0/s1 |
| InChIKey | PCIZFQVDNDHRPP-WOIVZMLFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ochraceus (ncbitaxon:40380) | mycelium (BTO:0001436) | PubMed (21043476) | MeOH(mycelia) & EtOAc(broth) extract of an endophytic fungus isolated from Sargassum kjellmanianum Strain: EN 31 |
| Penicillium commune (ncbitaxon:36653) | mycelium (BTO:0001436) | PubMed (21226488) | Methanolic extract of mycelia and ethyl acetate extract of culture broth |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (22E,24R)-ergosta-5α,6α-epoxide-8,22-diene-3β,7α-diol (CHEBI:70339) has role Aspergillus metabolite (CHEBI:76956) |
| (22E,24R)-ergosta-5α,6α-epoxide-8,22-diene-3β,7α-diol (CHEBI:70339) has role Penicillium metabolite (CHEBI:76964) |
| (22E,24R)-ergosta-5α,6α-epoxide-8,22-diene-3β,7α-diol (CHEBI:70339) is a 3β-hydroxy steroid (CHEBI:36836) |
| (22E,24R)-ergosta-5α,6α-epoxide-8,22-diene-3β,7α-diol (CHEBI:70339) is a 7α-hydroxy steroid (CHEBI:36843) |
| (22E,24R)-ergosta-5α,6α-epoxide-8,22-diene-3β,7α-diol (CHEBI:70339) is a epoxy steroid (CHEBI:145217) |
| (22E,24R)-ergosta-5α,6α-epoxide-8,22-diene-3β,7α-diol (CHEBI:70339) is a ergostanoid (CHEBI:50403) |
| IUPAC Name |
|---|
| (3β,5α,6α,7α,22E)-5,6-epoxyergosta-8,22-diene-3,7-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:54087 | Reaxys |
| Citations |
|---|