EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O2 |
| Net Charge | 0 |
| Average Mass | 414.674 |
| Monoisotopic Mass | 414.34978 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC[C@@]1([H])C2=C[C@@H](O)C2C[C@@H](O)CC[C@@]21C |
| InChI | InChI=1S/C28H46O2/c1-17(2)18(3)7-8-19(4)22-9-10-23-21-16-26(30)25-15-20(29)11-13-28(25,6)24(21)12-14-27(22,23)5/h7-8,16-20,22-26,29-30H,9-15H2,1-6H3/b8-7+/t18-,19+,20-,22+,23-,24-,25?,26+,27+,28+/m0/s1 |
| InChIKey | HGGDUZQCHPXQPL-DJTZJKDYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ochraceus (ncbitaxon:40380) | mycelium (BTO:0001436) | PubMed (21043476) | MeOH(mycelia) & EtOAc(broth) extract of an endophytic fungus isolated from Sargassum kjellmanianum Strain: EN 31 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (22E,24R)-ergosta-7,22-diene-3β,6β-diol (CHEBI:70338) has role Aspergillus metabolite (CHEBI:76956) |
| (22E,24R)-ergosta-7,22-diene-3β,6β-diol (CHEBI:70338) is a 3β-hydroxy steroid (CHEBI:36836) |
| (22E,24R)-ergosta-7,22-diene-3β,6β-diol (CHEBI:70338) is a 5β-hydroxy steroid (CHEBI:38195) |
| (22E,24R)-ergosta-7,22-diene-3β,6β-diol (CHEBI:70338) is a ergostanoid (CHEBI:50403) |
| IUPAC Name |
|---|
| (3β,6β,22E)-ergosta-7,22-diene-3,6-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5302651 | Reaxys |
| Citations |
|---|