EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O3 |
| Net Charge | 0 |
| Average Mass | 428.657 |
| Monoisotopic Mass | 428.32905 |
| SMILES | [H][C@@]12CC(=O)C3=C([C@H](O)C[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC(=C)C(C)C)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C28H44O3/c1-16(2)17(3)7-8-18(4)21-9-10-22-25-23(30)14-19-13-20(29)11-12-27(19,5)26(25)24(31)15-28(21,22)6/h16,18-22,24,29,31H,3,7-15H2,1-2,4-6H3/t18-,19-,20+,21-,22+,24-,27+,28-/m1/s1 |
| InChIKey | IWSQIMKLMWQADE-MOKAYLCWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ochraceus (ncbitaxon:40380) | mycelium (BTO:0001436) | PubMed (21043476) | MeOH(mycelia) & EtOAc(broth) extract of an endophytic fungus isolated from Sargassum kjellmanianum Strain: EN 31 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β,11α-dihydroxyergosta-8,24(28)-dien-7-one (CHEBI:70333) has parent hydride 5α-ergostane (CHEBI:20652) |
| 3β,11α-dihydroxyergosta-8,24(28)-dien-7-one (CHEBI:70333) has role Aspergillus metabolite (CHEBI:76956) |
| 3β,11α-dihydroxyergosta-8,24(28)-dien-7-one (CHEBI:70333) is a 11α-hydroxy steroid (CHEBI:19129) |
| 3β,11α-dihydroxyergosta-8,24(28)-dien-7-one (CHEBI:70333) is a 3β-hydroxy steroid (CHEBI:36836) |
| 3β,11α-dihydroxyergosta-8,24(28)-dien-7-one (CHEBI:70333) is a 7-oxo steroid (CHEBI:47789) |
| 3β,11α-dihydroxyergosta-8,24(28)-dien-7-one (CHEBI:70333) is a ergostanoid (CHEBI:50403) |
| IUPAC Name |
|---|
| (3β,5α,11α)-3,11-dihydroxyergosta-8,24(28)-dien-7-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21092009 | Reaxys |
| Citations |
|---|