EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O3 |
| Net Charge | 0 |
| Average Mass | 414.630 |
| Monoisotopic Mass | 414.31340 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)C(C)C)[C@@]1(C)CCC1=C2OC(=O)[C@@]2([H])C[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C27H42O3/c1-16(2)17(3)7-8-18(4)20-9-10-21-24-22(12-14-26(20,21)5)27(6)13-11-19(28)15-23(27)25(29)30-24/h16,18-21,23,28H,3,7-15H2,1-2,4-6H3/t18-,19+,20-,21+,23-,26-,27-/m1/s1 |
| InChIKey | UPMCJHRCQLXGPP-GOZBUJHGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ochraceus (ncbitaxon:40380) | mycelium (BTO:0001436) | PubMed (21043476) | MeOH(mycelia) & EtOAc(broth) extract of an endophytic fungus isolated from Sargassum kjellmanianum Strain: EN 31 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-nor-ergosterolide (CHEBI:70332) has role Aspergillus metabolite (CHEBI:76956) |
| 7-nor-ergosterolide (CHEBI:70332) has role antineoplastic agent (CHEBI:35610) |
| 7-nor-ergosterolide (CHEBI:70332) is a 3β-hydroxy steroid (CHEBI:36836) |
| 7-nor-ergosterolide (CHEBI:70332) is a steroid lactone (CHEBI:26766) |
| IUPAC Name |
|---|
| (1R,3aR,5aS,7S,9aS,11aR)-7-hydroxy-9a,11a-dimethyl-1-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,3a,5a,6,7,8,9,9a,10,11,11a-dodecahydrobenzo[c]cyclopenta[h]chromen-5(1H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21092007 | Reaxys |
| Citations |
|---|