EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H20O11 |
| Net Charge | 0 |
| Average Mass | 556.479 |
| Monoisotopic Mass | 556.10056 |
| SMILES | O=C1c2c(O)cc(O)cc2O[C@@H](c2ccc(O)cc2)[C@@H]1c1c(O)cc(O)c2c(=O)cc(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C30H20O11/c31-14-4-1-12(2-5-14)29-27(28(39)25-18(35)8-15(32)9-23(25)41-29)26-20(37)10-19(36)24-21(38)11-22(40-30(24)26)13-3-6-16(33)17(34)7-13/h1-11,27,29,31-37H/t27-,29+/m1/s1 |
| InChIKey | GFWPWSNIXRDQJC-PXJZQJOASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia livingstonei (ncbitaxon:469932) | fruit (BTO:0000486) | PubMed (21028890) | |
| Rheedia edulis (ncbitaxon:156481) | exocarp (BTO:0000733) | PubMed (21028890) | MeOH extract of blended rind(exocarp) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-morelloflavone (CHEBI:70331) has role plant metabolite (CHEBI:76924) |
| (+)-morelloflavone (CHEBI:70331) is a biflavonoid (CHEBI:50128) |
| (+)-morelloflavone (CHEBI:70331) is a hydroxyflavanone (CHEBI:24697) |
| (+)-morelloflavone (CHEBI:70331) is a hydroxyflavone (CHEBI:24698) |
| IUPAC Name |
|---|
| (2R,3S)-2'-(3,4-dihydroxyphenyl)-5,5',7,7'-tetrahydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H,4'H-[3,8'-bi-1-benzopyran]-4,4'-dione |
| Synonym | Source |
|---|---|
| Fukugetin | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00006435 | KNApSAcK |
| Morelloflavone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1633274 | Reaxys |
| CAS:16851-21-1 | ChemIDplus |
| Citations |
|---|