EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H50O6 |
| Net Charge | 0 |
| Average Mass | 602.812 |
| Monoisotopic Mass | 602.36074 |
| SMILES | CC(C)=CC[C@@H]1C[C@]23C[C@@H](CC=C(C)C)C(C)(C)[C@](CC=C(C)C)(C(=O)C(C(=O)c4ccc(O)c(O)c4)=C2OC1(C)C)C3=O |
| InChI | InChI=1S/C38H50O6/c1-22(2)11-14-26-20-37-21-27(15-12-23(3)4)36(9,10)44-33(37)30(31(41)25-13-16-28(39)29(40)19-25)32(42)38(34(37)43,35(26,7)8)18-17-24(5)6/h11-13,16-17,19,26-27,39-40H,14-15,18,20-21H2,1-10H3/t26-,27-,37-,38-/m1/s1 |
| InChIKey | KXTNVBQRLRYVCO-OGHRFRAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rheedia edulis (ncbitaxon:156481) | seed (BTO:0001226) | PubMed (21028890) | MeOH extract of powdered seeds |
| Garcinia livingstonei (ncbitaxon:469932) | fruit (BTO:0000486) | PubMed (21028890) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoxanthochymol (CHEBI:70329) has role metabolite (CHEBI:25212) |
| isoxanthochymol (CHEBI:70329) is a monoterpenoid (CHEBI:25409) |
| Synonym | Source |
|---|---|
| 9H-4a,8-Methano-2H-cycloocta(b)pyran-9,11-dione, 10-(3,4-dihydroxybenzoyl)-3,4,5,6,7,8-hexahydro-2,2,7,7-tetramethyl-3,6,8-tris(3-methyl-2-butenyl)-, (3R,4aR,6R,8S)- | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:52617-33-1 | ChemIDplus |
| Citations |
|---|