EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H50O6 |
| Net Charge | 0 |
| Average Mass | 602.812 |
| Monoisotopic Mass | 602.36074 |
| SMILES | C=C(C)CC[C@H](C[C@]12C[C@H](CC=C(C)C)C(C)(C)[C@](CC=C(C)C)(C(=O)C(C(=O)c3ccc(O)c(O)c3)=C1O)C2=O)C(=C)C |
| InChI | InChI=1S/C38H50O6/c1-22(2)11-13-27(25(7)8)20-37-21-28(15-12-23(3)4)36(9,10)38(35(37)44,18-17-24(5)6)34(43)31(33(37)42)32(41)26-14-16-29(39)30(40)19-26/h12,14,16-17,19,27-28,39-40,42H,1,7,11,13,15,18,20-21H2,2-6,8-10H3/t27-,28+,37+,38-/m1/s1 |
| InChIKey | ZLMZRAYSIVLUPA-AKAMJVKKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia livingstonei (ncbitaxon:469932) | fruit (BTO:0000486) | PubMed (21028890) | |
| Rheedia edulis (ncbitaxon:156481) | seed (BTO:0001226) | PubMed (21028890) | MeOH extract of powdered seeds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthochymol (CHEBI:70327) has role metabolite (CHEBI:25212) |
| xanthochymol (CHEBI:70327) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Bicyclo(3.3.1)non-3-ene-2,9-dione, 3-(3,4-dihydroxybenzoyl)-4-hydroxy-8,8-dimethyl-1,7-bis(3-methyl-2-butenyl)-5-(5-methyl-2-(1-methylethenyl)-5-hexenyl)-, (1S-(1alpha,5alpha,5(S*),7beta)) | ChEBI |
| Xanthochymol | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:52617-32-0 | KEGG COMPOUND |
| CAS:52617-32-0 | ChemIDplus |
| Citations |
|---|