EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H50O6 |
| Net Charge | 0 |
| Average Mass | 602.812 |
| Monoisotopic Mass | 602.36074 |
| SMILES | CC(C)=CCC[C@@]1(C)[C@H](CC=C(C)C)C[C@@]2(CC=C(C)C)C(=O)[C@]1(CC=C(C)C)C(=O)C(C(=O)c1ccc(O)c(O)c1)=C2O |
| InChI | InChI=1S/C38H50O6/c1-23(2)11-10-18-36(9)28(14-12-24(3)4)22-37(19-16-25(5)6)33(42)31(32(41)27-13-15-29(39)30(40)21-27)34(43)38(36,35(37)44)20-17-26(7)8/h11-13,15-17,21,28,39-40,42H,10,14,18-20,22H2,1-9H3/t28-,36+,37-,38+/m1/s1 |
| InChIKey | QKKRBNPMUBNTPA-OQDRYOJTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia livingstonei (ncbitaxon:469932) | fruit (BTO:0000486) | PubMed (21028890) | |
| Rheedia edulis (ncbitaxon:156481) | seed (BTO:0001226) | PubMed (21028890) | MeOH extract of powdered seeds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guttiferone A, (rel-(+))- (CHEBI:70326) has role metabolite (CHEBI:25212) |
| guttiferone A, (rel-(+))- (CHEBI:70326) is a monoterpenoid (CHEBI:25409) |
| Synonym | Source |
|---|---|
| rel-(1R,3E,5S,6R,7S)-3-[(3,4-dihydroxyphenyl)-hydroxymethylidene]-6-methyl-1,5,7-tris(3-methylbut-2-enyl)-6-(4-methylpent-3-enyl)bicyclo[3.3.1]nonane-2,4,9-trione | ChEBI |
| Citations |
|---|