EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H42O4 |
| Net Charge | 0 |
| Average Mass | 502.695 |
| Monoisotopic Mass | 502.30831 |
| SMILES | CC(C)=CC[C@@H]1C[C@@]2(CC=C(C)C)C(=O)[C@](CC=C(C)C)(C(=O)C(C(=O)c3ccccc3)=C2O)C1(C)C |
| InChI | InChI=1S/C33H42O4/c1-21(2)14-15-25-20-32(18-16-22(3)4)28(35)26(27(34)24-12-10-9-11-13-24)29(36)33(30(32)37,31(25,7)8)19-17-23(5)6/h9-14,16-17,25,35H,15,18-20H2,1-8H3/t25-,32-,33+/m1/s1 |
| InChIKey | JXKKYQPCNJMAHZ-BJEYHHSBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rheedia edulis (ncbitaxon:156481) | seed (BTO:0001226) | PubMed (21028890) | MeOH extract of powdered seeds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-epi-clusianone, (rel)- (CHEBI:70325) has role metabolite (CHEBI:25212) |
| 6-epi-clusianone, (rel)- (CHEBI:70325) is a monoterpenoid (CHEBI:25409) |
| Synonym | Source |
|---|---|
| rel-(1R,5R,7R)-3-benzoyl-4-hydroxy-8,8-dimethyl-1,5,7-tris(3-methylbut-2-en-1-yl)bicyclo[3.3.1]non-3-ene-2,9-dione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 23326959 | ChemSpider |
| Citations |
|---|