EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H50O5 |
| Net Charge | 0 |
| Average Mass | 586.813 |
| Monoisotopic Mass | 586.36582 |
| SMILES | CC(C)=CCC[C@@]1(C)[C@@H](CC=C(C)C)C[C@]2(CC=C(C)C)C(=O)[C@@]1(CC=C(C)C)C(=O)C(C(=O)c1cccc(O)c1)=C2O |
| InChI | InChI=1S/C38H50O5/c1-24(2)12-11-19-36(9)29(16-15-25(3)4)23-37(20-17-26(5)6)33(41)31(32(40)28-13-10-14-30(39)22-28)34(42)38(36,35(37)43)21-18-27(7)8/h10,12-15,17-18,22,29,39,41H,11,16,19-21,23H2,1-9H3/t29-,36-,37-,38+/m0/s1 |
| InChIKey | BRKJGVUPNGKMRP-RHOXKHGNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rheedia edulis (ncbitaxon:156481) | seed (BTO:0001226) | PubMed (21028890) | MeOH extract of powdered seeds |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-epi-guttiferone J (CHEBI:70324) has role metabolite (CHEBI:25212) |
| 6-epi-guttiferone J (CHEBI:70324) is a monoterpenoid (CHEBI:25409) |
| Synonym | Source |
|---|---|
| (1S,5S,7S,8S)-4-Hydroxy-3-(3-hydroxybenzoyl)-8-methyl-1,5,7-tris(3-methyl-2-buten-1-yl)-8-(4-methyl-3-penten-1-yl)bicyclo[3.3.1]non-3-ene-2,9-dione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 28288247 | ChemSpider |
| Citations |
|---|