EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O4 |
| Net Charge | 0 |
| Average Mass | 454.651 |
| Monoisotopic Mass | 454.30831 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)[C@H](C)C(=O)O)[C@@]1(C)CC(=O)C1=C2CC[C@@]2([H])[C@H](C)C(=O)CC[C@]12C |
| InChI | InChI=1S/C29H42O4/c1-16(18(3)27(32)33)7-8-17(2)21-11-12-23-20-9-10-22-19(4)24(30)13-14-28(22,5)26(20)25(31)15-29(21,23)6/h17-19,21-23H,1,7-15H2,2-6H3,(H,32,33)/t17-,18+,19+,21-,22+,23+,28+,29-/m1/s1 |
| InChIKey | WTSUWKBKPMVEBO-QNMMDLTMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| antcin A (CHEBI:70311) has role metabolite (CHEBI:25212) |
| antcin A (CHEBI:70311) is a ergostanoid (CHEBI:50403) |
| Synonym | Source |
|---|---|
| (4alpha,5alpha,25S)-4-Methyl-3,11-dioxoergosta-8,24(28)-dien-26-oic acid | ChEBI |
| Citations |
|---|