EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13N3O8 |
| Net Charge | 0 |
| Average Mass | 351.271 |
| Monoisotopic Mass | 351.07026 |
| SMILES | O=C(O)C1=C/C(=C/C=N\[C@H](C(=O)O)c2cc(O)no2)C[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C14H13N3O8/c18-10-5-9(25-17-10)11(14(23)24)15-2-1-6-3-7(12(19)20)16-8(4-6)13(21)22/h1-3,5,8,11,16H,4H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24)/b6-1-,15-2-/t8-,11-/m0/s1 |
| InChIKey | AVQHQGYBRFPNMT-JOPLDPTKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Musca-aurin-I (CHEBI:7031) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Musca-aurin-I | KEGG COMPOUND |