EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O4 |
| Net Charge | 0 |
| Average Mass | 468.678 |
| Monoisotopic Mass | 468.32396 |
| SMILES | [H][C@@]12CCC3=C(C(=O)C[C@@]4(C)[C@]3([H])CC[C@]4([H])[C@H](C)CCC(=C)C(C)C(=O)OC)[C@@]1(C)CCC(=O)[C@H]2C |
| InChI | InChI=1S/C30H44O4/c1-17(19(3)28(33)34-7)8-9-18(2)22-12-13-24-21-10-11-23-20(4)25(31)14-15-29(23,5)27(21)26(32)16-30(22,24)6/h18-20,22-24H,1,8-16H2,2-7H3/t18-,19?,20+,22-,23+,24-,29+,30-/m1/s1 |
| InChIKey | JVQOVXPSHOWVQH-SZXXUZGLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Camphoratin J (CHEBI:70309) has role metabolite (CHEBI:25212) |
| Camphoratin J (CHEBI:70309) is a ergostanoid (CHEBI:50403) |
| Synonym | Source |
|---|---|
| methyl 3,11-dioxo-4alpha-methyl-14beta-ergosta-8,24(28)-dien-26-oate | ChEBI |
| Citations |
|---|