EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O2 |
| Net Charge | 0 |
| Average Mass | 412.658 |
| Monoisotopic Mass | 412.33413 |
| SMILES | [H][C@@]12CC=C3[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)/C=C/[C@H](C)[C@H](C)CO)[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C28H44O2/c1-18(20(3)17-29)6-7-19(2)24-10-11-25-23-9-8-21-16-22(30)12-14-27(21,4)26(23)13-15-28(24,25)5/h6-7,9,18-21,24-26,29H,8,10-17H2,1-5H3/b7-6+/t18-,19+,20+,21-,24+,25-,26-,27-,28+/m0/s1 |
| InChIKey | HCQKGAYOZHKURE-TVBBQBQJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Camphoratin I (CHEBI:70308) has role metabolite (CHEBI:25212) |
| Camphoratin I (CHEBI:70308) is a ergostanoid (CHEBI:50403) |
| Synonym | Source |
|---|---|
| (25S)-26-hydroxyergosta-7,22-dien-3-one | ChEBI |
| Citations |
|---|