EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O2 |
| Net Charge | 0 |
| Average Mass | 424.669 |
| Monoisotopic Mass | 424.33413 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)C(C)C)[C@@]1(C)CC(=O)C1=C2CC[C@@]2([H])[C@H](C)C(=O)CC[C@]12C |
| InChI | InChI=1S/C29H44O2/c1-17(2)18(3)8-9-19(4)22-12-13-24-21-10-11-23-20(5)25(30)14-15-28(23,6)27(21)26(31)16-29(22,24)7/h17,19-20,22-24H,3,8-16H2,1-2,4-7H3/t19-,20+,22-,23+,24+,28+,29-/m1/s1 |
| InChIKey | AYSIOTAFSDKQCL-TVLOBTIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Camphoratin H (CHEBI:70307) has role metabolite (CHEBI:25212) |
| Camphoratin H (CHEBI:70307) is a ergostanoid (CHEBI:50403) |
| Synonym | Source |
|---|---|
| 4alpha-methylergosta-8,24(28)-diene-3,11-dione | ChEBI |
| Citations |
|---|