EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O5 |
| Net Charge | 0 |
| Average Mass | 484.677 |
| Monoisotopic Mass | 484.31887 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=C)C(C)C(=O)OC)[C@@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@]2([H])[C@H](C)C(=O)CC[C@]12C |
| InChI | InChI=1S/C30H44O5/c1-16(18(3)28(34)35-7)8-9-17(2)20-10-11-21-26-24(32)14-22-19(4)23(31)12-13-29(22,5)27(26)25(33)15-30(20,21)6/h17-22,24,32H,1,8-15H2,2-7H3/t17-,18?,19+,20-,21+,22+,24+,29+,30-/m1/s1 |
| InChIKey | KREJDSDDOCJSGN-VFJZLOOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to old hollow trunks of Cinnamomum kanehirai, EtOH extract, epimeric mixture at C-25 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Camphoratin F (CHEBI:70305) has role metabolite (CHEBI:25212) |
| Camphoratin F (CHEBI:70305) is a bile acid (CHEBI:3098) |
| Synonym | Source |
|---|---|
| methyl 7beta-hydroxy-3,11-dioxo-4alpha-methylergosta-8,24(28)-dien-26-oate | ChEBI |
| Citations |
|---|