EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42O6 |
| Net Charge | 0 |
| Average Mass | 486.649 |
| Monoisotopic Mass | 486.29814 |
| SMILES | [H][C@@]12CC(=O)C3=C(C(=O)C[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC(=C)C(C)C(=O)O)[C@@]1(C)CC[C@@H](O)[C@]2(C)O |
| InChI | InChI=1S/C29H42O6/c1-15(17(3)26(33)34)7-8-16(2)18-9-10-19-24-20(30)13-22-27(4,12-11-23(32)29(22,6)35)25(24)21(31)14-28(18,19)5/h16-19,22-23,32,35H,1,7-14H2,2-6H3,(H,33,34)/t16-,17?,18-,19+,22-,23-,27+,28-,29-/m1/s1 |
| InChIKey | VQOGQXBQGQLQDY-JUVRMLKSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taiwanofungus camphoratus (ncbitaxon:196114) | fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Camphoratin C (CHEBI:70302) has role metabolite (CHEBI:25212) |
| Camphoratin C (CHEBI:70302) is a cholanoid (CHEBI:36078) |
| Synonym | Source |
|---|---|
| 3alpha,4beta-dihydroxy-7,11-dioxo-4alpha-methylergosta-8,24(28)-dien-26-oic acid | ChEBI |
| Citations |
|---|