EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N4O6 |
| Net Charge | 0 |
| Average Mass | 348.315 |
| Monoisotopic Mass | 348.10698 |
| SMILES | N[C@@H](CC1=C/[N+](=C\C=C2\C=C(C(=O)O)N[C@H](C(=O)O)C2)C=N1)C(=O)[O-] |
| InChI | InChI=1S/C15H16N4O6/c16-10(13(20)21)5-9-6-19(7-17-9)2-1-8-3-11(14(22)23)18-12(4-8)15(24)25/h1-3,6-7,10,12H,4-5,16H2,(H3,20,21,22,23,24,25)/t10-,12-/m0/s1 |
| InChIKey | OROLDOQHKPWCGQ-JQWIXIFHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Musca-aurin VII (CHEBI:7030) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Musca-aurin VII | KEGG COMPOUND |