EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H44O8 |
| Net Charge | 0 |
| Average Mass | 592.729 |
| Monoisotopic Mass | 592.30362 |
| SMILES | CCCC(=O)c1c(O)c2c(c(CC3=C(O)C(C)(C/C=C(\C)CCC=C(C)C)C(O)=C(C(C)=O)C3=O)c1O)OC(C)(C)C=C2 |
| InChI | InChI=1S/C35H44O8/c1-9-11-25(37)27-28(38)22-15-16-34(6,7)43-31(22)23(29(27)39)18-24-30(40)26(21(5)36)33(42)35(8,32(24)41)17-14-20(4)13-10-12-19(2)3/h12,14-16,38-39,41-42H,9-11,13,17-18H2,1-8H3/b20-14+ |
| InChIKey | HEQHKIYIPQMWBL-XSFVSMFZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Elaphoglossum yungense (ncbitaxon:551654) | |||
| root (BTO:0001188) | PubMed (21043474) | Et2O extract of air-dried and ground scaly rhizomes and roots | |
| rhizome (BTO:0001181) | PubMed (21043474) | Et2O extract of air-dried and ground scaly rhizomes and roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Yungensin F (CHEBI:70299) has role metabolite (CHEBI:25212) |
| Yungensin F (CHEBI:70299) is a 1-benzopyran (CHEBI:38443) |
| Synonym | Source |
|---|---|
| 2-{[5,7-dihydroxy-2,2-dimethyl-6-butanoyl-8-chromenyl]methyl}-3,5-dihydroxy-4-methyl-4-(3,7-dimethyl-2,6-octadienyl)-6-acetyl-2,5-cyclohexadien-1-one | ChEBI |
| Citations |
|---|