EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H46O8 |
| Net Charge | 0 |
| Average Mass | 594.745 |
| Monoisotopic Mass | 594.31927 |
| SMILES | CCCC(=O)c1c(O)c(CC=C(C)C)c(O)c(CC2=C(O)C(C)(C/C=C(\C)CCC=C(C)C)C(O)=C(C(C)=O)C2=O)c1O |
| InChI | InChI=1S/C35H46O8/c1-9-11-26(37)28-30(39)23(15-14-20(4)5)29(38)24(31(28)40)18-25-32(41)27(22(7)36)34(43)35(8,33(25)42)17-16-21(6)13-10-12-19(2)3/h12,14,16,38-40,42-43H,9-11,13,15,17-18H2,1-8H3/b21-16+ |
| InChIKey | DPDVRLNGFWFYRI-LTGZKZEYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Elaphoglossum yungense (ncbitaxon:551654) | |||
| rhizome (BTO:0001181) | PubMed (21043474) | Et2O extract of air-dried and ground scaly rhizomes and roots | |
| root (BTO:0001188) | PubMed (21043474) | Et2O extract of air-dried and ground scaly rhizomes and roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Yungensin D (CHEBI:70297) has functional parent phloroglucinol (CHEBI:16204) |
| Yungensin D (CHEBI:70297) has role metabolite (CHEBI:25212) |
| Yungensin D (CHEBI:70297) is a carboxylic ester (CHEBI:33308) |
| Synonym | Source |
|---|---|
| 2-{[2,4,6-trihydroxy-5-(3-methyl-2-butenyl)-3-butanoylphenyl]methyl}-3,5-dihydroxy-4-methyl-4-(3,7-dimethyl-2,6-octadienyl)-6-acetyl-2,5-cyclohexadien-1-one | ChEBI |
| Citations |
|---|