EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H11ClO7 |
| Net Charge | 0 |
| Average Mass | 350.710 |
| Monoisotopic Mass | 350.01933 |
| SMILES | COC(=O)[C@H]1OC(=O)C=C(Cl)c2oc3cc(C)cc(O)c3c(=O)c21 |
| InChI | InChI=1S/C16H11ClO7/c1-6-3-8(18)11-9(4-6)23-14-7(17)5-10(19)24-15(16(21)22-2)12(14)13(11)20/h3-5,15,18H,1-2H3/t15-/m0/s1 |
| InChIKey | XEADRORPHLTLNQ-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria sonchi (ncbitaxon:283360) | - | PubMed (26174176) | Strain: S-102 |
| Monilia fructicola (fungorum:360531) | - | PubMed (21082806) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chloromonilicin (CHEBI:70291) has role fungal metabolite (CHEBI:76946) |
| chloromonilicin (CHEBI:70291) has role plant metabolite (CHEBI:76924) |
| chloromonilicin (CHEBI:70291) is a methyl ester (CHEBI:25248) |
| chloromonilicin (CHEBI:70291) is a organic heterotricyclic compound (CHEBI:26979) |
| chloromonilicin (CHEBI:70291) is a organochlorine compound (CHEBI:36683) |
| chloromonilicin (CHEBI:70291) is a ε-lactone (CHEBI:50239) |
| IUPAC Name |
|---|
| methyl (1S)-5-chloro-10-hydroxy-8-methyl-3,11-dioxo-3,11-dihydro-1H-oxepino[4,3-b]chromene-1-carboxylate |
| Synonyms | Source |
|---|---|
| (1S)-chloromonilicin | ChEBI |
| (+)-chloromonilicin | ChEBI |
| chloromonilicin, (+)- | ChEBI |
| (S)-chloromonilicin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00018634 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:96287-38-6 | ChemIDplus |
| Citations |
|---|