EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O3 |
| Net Charge | 0 |
| Average Mass | 190.198 |
| Monoisotopic Mass | 190.06299 |
| SMILES | Cc1cc(O)c2c(=O)cc(C)oc2c1 |
| InChI | InChI=1S/C11H10O3/c1-6-3-8(12)11-9(13)5-7(2)14-10(11)4-6/h3-5,12H,1-2H3 |
| InChIKey | CQQPWPMDQBZIRH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria (ncbitaxon:5598) | - | PubMed (21082806) | |
| Alternaria brassicicola (ncbitaxon:29001) | - | PubMed (21082806) | |
| Hypoxylon truncatum (ncbitaxon:327061) | - | PubMed (21082806) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Altechromone A (CHEBI:70290) has role metabolite (CHEBI:25212) |
| Altechromone A (CHEBI:70290) is a chromones (CHEBI:23238) |
| Synonym | Source |
|---|---|
| 5-Hydroxy-2,7-dimethylchromone | ChEBI |
| Citations |
|---|