EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7029 - Musaroside
| Formula | C30H44O10 |
| Net Charge | 0 |
| Average Mass | 564.672 |
| Monoisotopic Mass | 564.29345 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@]4(O)CC[C@]([H])(C5=CC(=O)OC5)[C@@]4(C)[C@H](O)C(=O)[C@]3([H])[C@@]1(C)CC[C@H](O[C@@H]1O[C@H](C)[C@H](O)[C@H](OC)[C@H]1O)C2 |
| InChI | InChI=1S/C30H44O10/c1-14-22(32)25(37-4)24(34)27(39-14)40-17-7-9-28(2)16(12-17)5-6-19-21(28)23(33)26(35)29(3)18(8-10-30(19,29)36)15-11-20(31)38-13-15/h11,14,16-19,21-22,24-27,32,34-36H,5-10,12-13H2,1-4H3/t14-,16-,17+,18-,19-,21-,22+,24-,25+,26-,27+,28+,29+,30+/m1/s1 |
| InChIKey | TYVPUZUDLFQZOP-CROJTKMBSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Musaroside (CHEBI:7029) is a cardenolide glycoside (CHEBI:38092) |
| Synonyms | Source |
|---|---|
| Musaroside | KEGG COMPOUND |
| Sarmutogenin 3-O-beta-D-digitaloside | KEGG COMPOUND |