EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25NO5 |
| Net Charge | 0 |
| Average Mass | 383.444 |
| Monoisotopic Mass | 383.17327 |
| SMILES | CCC(/C=C/C=C/C=C/C(O)=C1\C(=O)NC(Cc2ccc(O)cc2)C1=O)CO |
| InChI | InChI=1S/C22H25NO5/c1-2-15(14-24)7-5-3-4-6-8-19(26)20-21(27)18(23-22(20)28)13-16-9-11-17(25)12-10-16/h3-12,15,18,24-26H,2,13-14H2,1H3,(H,23,28)/b4-3+,7-5+,8-6+,20-19+ |
| InChIKey | TVSMLVYMTMBUHC-KGPDSPOASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Torrubiella (ncbitaxon:153665) | - | PubMed (21090800) | Ethyl acetate extract of culture broth, Torrubiella sp.isolated from a spider(araneae) Strain: BCC 2165 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Torrubiellone D (CHEBI:70289) has role metabolite (CHEBI:25212) |
| Torrubiellone D (CHEBI:70289) is a phenols (CHEBI:33853) |
| Synonym | Source |
|---|---|
| (3E)-3-[(2E,4E,6E)-1-hydroxy-8-(hydroxymethyl)deca-2,4,6-trienylidene]-5-[(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione | ChEBI |
| Citations |
|---|