EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23NO5 |
| Net Charge | 0 |
| Average Mass | 381.428 |
| Monoisotopic Mass | 381.15762 |
| SMILES | CCC(/C=C/C=C/C=C/C(=O)c1c(O)c(-c2ccc(O)cc2)cnc1=O)CO |
| InChI | InChI=1S/C22H23NO5/c1-2-15(14-24)7-5-3-4-6-8-19(26)20-21(27)18(13-23-22(20)28)16-9-11-17(25)12-10-16/h3-13,15,24-25H,2,14H2,1H3,(H2,23,27,28)/b4-3+,7-5+,8-6+ |
| InChIKey | BKSPTJGGAGGDSV-OKWWDJPNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Torrubiella (ncbitaxon:153665) | - | PubMed (21090800) | Ethyl acetate extract of culture broth, Torrubiella sp.isolated from a spider(araneae) Strain: BCC 2165 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Torrubiellone C (CHEBI:70288) has role metabolite (CHEBI:25212) |
| Torrubiellone C (CHEBI:70288) is a phenylpyridine (CHEBI:38193) |
| Synonym | Source |
|---|---|
| 4-hydroxy-3-[(2E,4E,6E)-8-(hydroxymethyl)deca-2,4,6-trienoyl]-5-(4-hydroxyphenyl)-1H-pyridin-2-one | ChEBI |
| Citations |
|---|