EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO6 |
| Net Charge | 0 |
| Average Mass | 403.475 |
| Monoisotopic Mass | 403.19949 |
| SMILES | CCC(/C=C/C=C/C=C/C(=O)c1c(O)c([C@]2(O)CC[C@@H](O)CC2)cnc1=O)CO |
| InChI | InChI=1S/C22H29NO6/c1-2-15(14-24)7-5-3-4-6-8-18(26)19-20(27)17(13-23-21(19)28)22(29)11-9-16(25)10-12-22/h3-8,13,15-16,24-25,29H,2,9-12,14H2,1H3,(H2,23,27,28)/b4-3+,7-5+,8-6+/t15?,16-,22+ |
| InChIKey | KQURUXJOTYKSMO-ZSBVLOQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Torrubiella (ncbitaxon:153665) | mycelium (BTO:0001436) | PubMed (21090800) | EtOAc extract of culture broth and MeOH extract of mycelia,fungus isolated from spider(araneae) Strain: BCC 2165 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Torrubiellone B, (cis)- (CHEBI:70287) has role metabolite (CHEBI:25212) |
| Torrubiellone B, (cis)- (CHEBI:70287) is a aromatic ketone (CHEBI:76224) |
| Synonym | Source |
|---|---|
| cis- 5-(1,4-dihydroxycyclohexyl)-4-hydroxy-3-[(2E,4E,6E)-8-(hydroxymethyl)deca-2,4,6-trienoyl]-1H-pyridin-2-one | ChEBI |
| Citations |
|---|