EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O5 |
| Net Charge | 0 |
| Average Mass | 376.493 |
| Monoisotopic Mass | 376.22497 |
| SMILES | [H][C@@]12CC=C(C)[C@H](C[C@@]34O[C@]3([H])C(O)C(C)=CC4O)[C@@]1(C)CCC[C@@]2(C)C(=O)O |
| InChI | InChI=1S/C22H32O5/c1-12-6-7-15-20(3,8-5-9-21(15,4)19(25)26)14(12)11-22-16(23)10-13(2)17(24)18(22)27-22/h6,10,14-18,23-24H,5,7-9,11H2,1-4H3,(H,25,26)/t14-,15+,16?,17?,18+,20+,21+,22-/m0/s1 |
| InChIKey | OQFXTROEGKHUNA-FUOIZCMPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraconiothyrium (ncbitaxon:300251) | mycelium (BTO:0001436) | PubMed (21114274) | Ethyl acetate extract of culture medium and mycelium |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epoxypholamin E, (rel)- (CHEBI:70285) has role metabolite (CHEBI:25212) |
| Epoxypholamin E, (rel)- (CHEBI:70285) is a polyol (CHEBI:26191) |
| Manual Xrefs | Databases |
|---|---|
| 27022536 | ChemSpider |
| Citations |
|---|