EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O4 |
| Net Charge | 0 |
| Average Mass | 362.510 |
| Monoisotopic Mass | 362.24571 |
| SMILES | [H][C@@]12CC=C(C)[C@H](C[C@@]34O[C@]3([H])[C@H](O)C(=C)[C@H](O)[C@@H]4O)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C22H34O4/c1-12-7-8-15-20(3,4)9-6-10-21(15,5)14(12)11-22-18(25)16(23)13(2)17(24)19(22)26-22/h7,14-19,23-25H,2,6,8-11H2,1,3-5H3/t14-,15-,16-,17+,18-,19+,21+,22-/m0/s1 |
| InChIKey | LVMIFHFLFLKUHJ-NGJQIILRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paraconiothyrium (ncbitaxon:300251) | mycelium (BTO:0001436) | PubMed (21114274) | Ethyl acetate extract of culture medium and mycelium |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epoxypholamin D, (rel)- (CHEBI:70284) has role metabolite (CHEBI:25212) |
| Epoxypholamin D, (rel)- (CHEBI:70284) is a cyclitol (CHEBI:23451) |
| Citations |
|---|